C25H48O7Si2 — CID 10887626
(E,2R)-4-[(1S,3R,8S,10R,11R)-13,13,15,15-tetra(propan-2-yl)-4,9,12,14,16-pentaoxa-13,15-disilatricyclo[9.5.0.03,8]hexadecan-10-yl]but-3-ene-1,2-diol (PubChem CID 10887626) has the molecular formula C25H48O7Si2 and a molecular weight of 516.82 g/mol. Its IUPAC name is (E,2R)-4-[(1S,3R,8S,10R,11R)-13,13,15,15-tetra(propan-2-yl)-4,9,12,14,16-pentaoxa-13,15-disilatricyclo[9.5.0.03,8]hexadecan-10-yl]but-3-ene-1,2-diol.
| Compound Name | (E,2R)-4-[(1S,3R,8S,10R,11R)-13,13,15,15-tetra(propan-2-yl)-4,9,12,14,16-pentaoxa-13,15-disilatricyclo[9.5.0.03,8]hexadecan-10-yl]but-3-ene-1,2-diol |
|---|---|
| PubChem CID | 10887626 |
| Molecular Formula | C25H48O7Si2 |
| Molecular Weight | 516.82 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | (E,2R)-4-[(1S,3R,8S,10R,11R)-13,13,15,15-tetra(propan-2-yl)-4,9,12,14,16-pentaoxa-13,15-disilatricyclo[9.5.0.03,8]hexadecan-10-yl]but-3-ene-1,2-diol |
| SMILES | CC(C)[Si]1(C(C)C)O[C@H]2[C@H](C[C@H]3OCCC[C@@H]3O[C@@H]2/C=C/[C@@H](O)CO)O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C25H48O7Si2/c1-16(2)33(17(3)4)30-24-14-23-21(10-9-13-28-23)29-22(12-11-20(27)15-26)25(24)31-34(32-33,18(5)6)19(7)8/h11-12,16-27H,9-10,13-15H2,1-8H3/b12-11+/t20-,21+,22-,23-,24+,25-/m1/s1 |
| InChIKey | LSRDQGGCPCMWKJ-ZBXLQXKESA-N |
| XLogP | 4.56 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.82 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|