C52H46N8O8+4 — CID 10887634
[4-[10,15,20-tris[1-(acetyloxymethyl)pyridin-1-ium-4-yl]-21,24-dihydroporphyrin-5-yl]pyridin-1-ium-1-yl]methyl acetate (PubChem CID 10887634) has the molecular formula C52H46N8O8+4 and a molecular weight of 910.99 g/mol. Its IUPAC name is [4-[10,15,20-tris[1-(acetyloxymethyl)pyridin-1-ium-4-yl]-21,24-dihydroporphyrin-5-yl]pyridin-1-ium-1-yl]methyl acetate.
| Compound Name | [4-[10,15,20-tris[1-(acetyloxymethyl)pyridin-1-ium-4-yl]-21,24-dihydroporphyrin-5-yl]pyridin-1-ium-1-yl]methyl acetate |
|---|---|
| PubChem CID | 10887634 |
| Molecular Formula | C52H46N8O8+4 |
| Molecular Weight | 910.99 g/mol |
| Exact Mass | 910.34 |
| IUPAC Name | [4-[10,15,20-tris[1-(acetyloxymethyl)pyridin-1-ium-4-yl]-21,24-dihydroporphyrin-5-yl]pyridin-1-ium-1-yl]methyl acetate |
| SMILES | CC(=O)OC[n+]1ccc(-c2c3nc(c(-c4cc[n+](COC(C)=O)cc4)c4ccc([nH]4)c(-c4cc[n+](COC(C)=O)cc4)c4ccc([nH]4)c(-c4cc[n+](COC(C)=O)cc4)c4nc2C=C4)C=C3)cc1 |
| InChI | InChI=1S/C52H45N8O8/c1-33(61)65-29-57-21-13-37(14-22-57)49-41-5-7-43(53-41)50(38-15-23-58(24-16-38)30-66-34(2)62)45-9-11-47(55-45)52(40-19-27-60(28-20-40)32-68-36(4)64)48-12-10-46(56-48)51(44-8-6-42(49)54-44)39-17-25-59(26-18-39)31-67-35(3)63/h5-28H,29-32H2,1-4H3,(H,53,54,55,56)/q+3/p+1/b49-41-,49-42-,50-43-,50-45-,51-44-,51-46-,52-47-,52-48- |
| InChIKey | AZXJWNXGMBMQSO-RCOMQYLTSA-O |
| XLogP | 6.56 |
| TPSA | 178.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.99 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|