C17H18NO4 — CID 10887775
CID 10887775 (PubChem CID 10887775) has the molecular formula C17H18NO4 and a molecular weight of 300.33 g/mol.
| Compound Name | CID 10887775 |
|---|---|
| PubChem CID | 10887775 |
| Molecular Formula | C17H18NO4 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | — |
| SMILES | COC(=O)[C@H](C[C]1[CH][CH][CH][CH]1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H18NO4/c1-21-16(19)15(11-13-7-5-6-8-13)18-17(20)22-12-14-9-3-2-4-10-14/h2-10,15H,11-12H2,1H3,(H,18,20)/t15-/m0/s1 |
| InChIKey | RPNQTMXYMMOZRE-HNNXBMFYSA-N |
| XLogP | 2.25 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |