About ethyl (Z)-pent-2-en-4-ynoate
ethyl (Z)-pent-2-en-4-ynoate (PubChem CID 10887897) has the molecular formula C7H8O2
and a molecular weight of 124.14 g/mol. Its IUPAC name is ethyl (Z)-pent-2-en-4-ynoate.
Molecular Properties
| Compound Name | ethyl (Z)-pent-2-en-4-ynoate |
| PubChem CID | 10887897 |
| Molecular Formula | C7H8O2 |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | ethyl (Z)-pent-2-en-4-ynoate |
| SMILES | C#C/C=C\C(=O)OCC |
| InChI | InChI=1S/C7H8O2/c1-3-5-6-7(8)9-4-2/h1,5-6H,4H2,2H3/b6-5- |
| InChIKey | HWZIPXLMNOMOJA-WAYWQWQTSA-N |
| XLogP | 0.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl (Z)-pent-2-en-4-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (Z)-pent-2-en-4-ynoate?
The IUPAC name of ethyl (Z)-pent-2-en-4-ynoate (CID 10887897) is ethyl (Z)-pent-2-en-4-ynoate.
What is the SMILES notation for ethyl (Z)-pent-2-en-4-ynoate?
The canonical SMILES for ethyl (Z)-pent-2-en-4-ynoate is C#C/C=C\C(=O)OCC.
What is the InChIKey of ethyl (Z)-pent-2-en-4-ynoate?
The InChIKey is HWZIPXLMNOMOJA-WAYWQWQTSA-N. The full InChI is InChI=1S/C7H8O2/c1-3-5-6-7(8)9-4-2/h1,5-6H,4H2,2H3/b6-5-.
What are the key properties of ethyl (Z)-pent-2-en-4-ynoate?
ethyl (Z)-pent-2-en-4-ynoate has a molecular weight of 124.14 g/mol, XLogP of 0.74, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (Z)-pent-2-en-4-ynoate is sourced from PubChem (CID 10887897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).