C18H20N2O4 — CID 108879120
2-[4-[(3,4-dimethylphenoxy)methylcarbamoylamino]phenyl]acetic acid (PubChem CID 108879120) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 2-[4-[(3,4-dimethylphenoxy)methylcarbamoylamino]phenyl]acetic acid.
| Compound Name | 2-[4-[(3,4-dimethylphenoxy)methylcarbamoylamino]phenyl]acetic acid |
|---|---|
| PubChem CID | 108879120 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 2-[4-[(3,4-dimethylphenoxy)methylcarbamoylamino]phenyl]acetic acid |
| SMILES | Cc1ccc(OCNC(=O)Nc2ccc(CC(=O)O)cc2)cc1C |
| InChI | InChI=1S/C18H20N2O4/c1-12-3-8-16(9-13(12)2)24-11-19-18(23)20-15-6-4-14(5-7-15)10-17(21)22/h3-9H,10-11H2,1-2H3,(H,21,22)(H2,19,20,23) |
| InChIKey | YCRZOIFSGUIHFX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|