C20H25N3O3 — CID 108879170
1-[(3,4-dimethylphenoxy)methyl]-3-(2-morpholin-4-ylphenyl)urea (PubChem CID 108879170) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 1-[(3,4-dimethylphenoxy)methyl]-3-(2-morpholin-4-ylphenyl)urea.
| Compound Name | 1-[(3,4-dimethylphenoxy)methyl]-3-(2-morpholin-4-ylphenyl)urea |
|---|---|
| PubChem CID | 108879170 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 1-[(3,4-dimethylphenoxy)methyl]-3-(2-morpholin-4-ylphenyl)urea |
| SMILES | Cc1ccc(OCNC(=O)Nc2ccccc2N2CCOCC2)cc1C |
| InChI | InChI=1S/C20H25N3O3/c1-15-7-8-17(13-16(15)2)26-14-21-20(24)22-18-5-3-4-6-19(18)23-9-11-25-12-10-23/h3-8,13H,9-12,14H2,1-2H3,(H2,21,22,24) |
| InChIKey | ISPYNIJHNMROMS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|