methyl 2-(methoxymethyl)prop-2-enoate

C6H10O3 — CID 10887940

IUPACmethyl 2-(methoxymethyl)prop-2-enoate
SMILESC=C(COC)C(=O)OC
InChIInChI=1S/C6H10O3/c1-5(4-8-2)6(7)9-3/h1,4H2,2-3H3
InChIKeyLHXULFYZCPMBMS-UHFFFAOYSA-N
MW130.14 g/mol
LogP0.36
Rot. Bonds3

About methyl 2-(methoxymethyl)prop-2-enoate

methyl 2-(methoxymethyl)prop-2-enoate (PubChem CID 10887940) has the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. Its IUPAC name is methyl 2-(methoxymethyl)prop-2-enoate.

Molecular Properties

Compound Namemethyl 2-(methoxymethyl)prop-2-enoate
PubChem CID10887940
Molecular FormulaC6H10O3
Molecular Weight130.14 g/mol
Exact Mass130.06
IUPAC Namemethyl 2-(methoxymethyl)prop-2-enoate
SMILESC=C(COC)C(=O)OC
InChIInChI=1S/C6H10O3/c1-5(4-8-2)6(7)9-3/h1,4H2,2-3H3
InChIKeyLHXULFYZCPMBMS-UHFFFAOYSA-N
XLogP0.36
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500130.14
LogP ≤ 50.36
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 2-(methoxymethyl)prop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(methoxymethyl)prop-2-enoate?
The IUPAC name of methyl 2-(methoxymethyl)prop-2-enoate (CID 10887940) is methyl 2-(methoxymethyl)prop-2-enoate.
What is the SMILES notation for methyl 2-(methoxymethyl)prop-2-enoate?
The canonical SMILES for methyl 2-(methoxymethyl)prop-2-enoate is C=C(COC)C(=O)OC.
What is the InChIKey of methyl 2-(methoxymethyl)prop-2-enoate?
The InChIKey is LHXULFYZCPMBMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3/c1-5(4-8-2)6(7)9-3/h1,4H2,2-3H3.
What are the key properties of methyl 2-(methoxymethyl)prop-2-enoate?
methyl 2-(methoxymethyl)prop-2-enoate has a molecular weight of 130.14 g/mol, XLogP of 0.36, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(methoxymethyl)prop-2-enoate is sourced from PubChem (CID 10887940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).