About [(E)-2-amino-1,2-dicyanoethenyl]cyanamide
[(E)-2-amino-1,2-dicyanoethenyl]cyanamide (PubChem CID 10887952) has the molecular formula C5H3N5
and a molecular weight of 133.11 g/mol. Its IUPAC name is [(E)-2-amino-1,2-dicyanoethenyl]cyanamide.
Molecular Properties
| Compound Name | [(E)-2-amino-1,2-dicyanoethenyl]cyanamide |
| PubChem CID | 10887952 |
| Molecular Formula | C5H3N5 |
| Molecular Weight | 133.11 g/mol |
| Exact Mass | 133.04 |
| IUPAC Name | [(E)-2-amino-1,2-dicyanoethenyl]cyanamide |
| SMILES | N#CN/C(C#N)=C(/N)C#N |
| InChI | InChI=1S/C5H3N5/c6-1-4(9)5(2-7)10-3-8/h10H,9H2/b5-4+ |
| InChIKey | GUTQUHGNJWHUHZ-SNAWJCMRSA-N |
| XLogP | -0.73 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.11 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze [(E)-2-amino-1,2-dicyanoethenyl]cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-2-amino-1,2-dicyanoethenyl]cyanamide?
The IUPAC name of [(E)-2-amino-1,2-dicyanoethenyl]cyanamide (CID 10887952) is [(E)-2-amino-1,2-dicyanoethenyl]cyanamide.
What is the SMILES notation for [(E)-2-amino-1,2-dicyanoethenyl]cyanamide?
The canonical SMILES for [(E)-2-amino-1,2-dicyanoethenyl]cyanamide is N#CN/C(C#N)=C(/N)C#N.
What is the InChIKey of [(E)-2-amino-1,2-dicyanoethenyl]cyanamide?
The InChIKey is GUTQUHGNJWHUHZ-SNAWJCMRSA-N. The full InChI is InChI=1S/C5H3N5/c6-1-4(9)5(2-7)10-3-8/h10H,9H2/b5-4+.
What are the key properties of [(E)-2-amino-1,2-dicyanoethenyl]cyanamide?
[(E)-2-amino-1,2-dicyanoethenyl]cyanamide has a molecular weight of 133.11 g/mol, XLogP of -0.73, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-2-amino-1,2-dicyanoethenyl]cyanamide is sourced from PubChem (CID 10887952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).