C10H14 — CID 10887961
2,7-dimethylocta-2,3,5,6-tetraene (PubChem CID 10887961) has the molecular formula C10H14 and a molecular weight of 134.22 g/mol. Its IUPAC name is 2,7-dimethylocta-2,3,5,6-tetraene.
| Compound Name | 2,7-dimethylocta-2,3,5,6-tetraene |
|---|---|
| PubChem CID | 10887961 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | 2,7-dimethylocta-2,3,5,6-tetraene |
| SMILES | CC(C)=C=CC=C=C(C)C |
| InChI | InChI=1S/C10H14/c1-9(2)7-5-6-8-10(3)4/h5-6H,1-4H3 |
| InChIKey | BGGRAZDBASETCM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|