C8H13NO — CID 10887991
(3aR,7aR)-1,3,3a,4,5,6,7,7a-octahydroindol-2-one (PubChem CID 10887991) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is (3aR,7aR)-1,3,3a,4,5,6,7,7a-octahydroindol-2-one.
| Compound Name | (3aR,7aR)-1,3,3a,4,5,6,7,7a-octahydroindol-2-one |
|---|---|
| PubChem CID | 10887991 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (3aR,7aR)-1,3,3a,4,5,6,7,7a-octahydroindol-2-one |
| SMILES | O=C1C[C@H]2CCCC[C@H]2N1 |
| InChI | InChI=1S/C8H13NO/c10-8-5-6-3-1-2-4-7(6)9-8/h6-7H,1-5H2,(H,9,10)/t6-,7-/m1/s1 |
| InChIKey | GFOOVKOSROWXAZ-RNFRBKRXSA-N |
| XLogP | 1.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |