C8H14O2 — CID 10888023
(3S,5R,6S)-3,5,6-trimethyloxan-2-one (PubChem CID 10888023) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is (3S,5R,6S)-3,5,6-trimethyloxan-2-one.
| Compound Name | (3S,5R,6S)-3,5,6-trimethyloxan-2-one |
|---|---|
| PubChem CID | 10888023 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | (3S,5R,6S)-3,5,6-trimethyloxan-2-one |
| SMILES | C[C@@H]1C[C@H](C)C(=O)O[C@H]1C |
| InChI | InChI=1S/C8H14O2/c1-5-4-6(2)8(9)10-7(5)3/h5-7H,4H2,1-3H3/t5-,6+,7+/m1/s1 |
| InChIKey | VKOQCQOCLWZTTK-VQVTYTSYSA-N |
| XLogP | 1.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |