hydrogen phosphite;oxovanadium(2+)

HO4PV — CID 10888058

IUPAChydrogen phosphite;oxovanadium(2+)
SMILESO=[V+2].[O-]P([O-])O
InChIInChI=1S/HO3P.O.V/c1-4(2)3;;/h1H;;/q-2;;+2
InChIKeyUCBURQGEKAEFHI-UHFFFAOYSA-N
MW146.92 g/mol
LogP-2.20
Rot. Bonds

About hydrogen phosphite;oxovanadium(2+)

hydrogen phosphite;oxovanadium(2+) (PubChem CID 10888058) has the molecular formula HO4PV and a molecular weight of 146.92 g/mol. Its IUPAC name is hydrogen phosphite;oxovanadium(2+).

Molecular Properties

Compound Namehydrogen phosphite;oxovanadium(2+)
PubChem CID10888058
Molecular FormulaHO4PV
Molecular Weight146.92 g/mol
Exact Mass146.91
IUPAC Namehydrogen phosphite;oxovanadium(2+)
SMILESO=[V+2].[O-]P([O-])O
InChIInChI=1S/HO3P.O.V/c1-4(2)3;;/h1H;;/q-2;;+2
InChIKeyUCBURQGEKAEFHI-UHFFFAOYSA-N
XLogP-2.20
TPSA83.42 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms6
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500146.92
LogP ≤ 5-2.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze hydrogen phosphite;oxovanadium(2+) with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hydrogen phosphite;oxovanadium(2+)?
The IUPAC name of hydrogen phosphite;oxovanadium(2+) (CID 10888058) is hydrogen phosphite;oxovanadium(2+).
What is the SMILES notation for hydrogen phosphite;oxovanadium(2+)?
The canonical SMILES for hydrogen phosphite;oxovanadium(2+) is O=[V+2].[O-]P([O-])O.
What is the InChIKey of hydrogen phosphite;oxovanadium(2+)?
The InChIKey is UCBURQGEKAEFHI-UHFFFAOYSA-N. The full InChI is InChI=1S/HO3P.O.V/c1-4(2)3;;/h1H;;/q-2;;+2.
What are the key properties of hydrogen phosphite;oxovanadium(2+)?
hydrogen phosphite;oxovanadium(2+) has a molecular weight of 146.92 g/mol, XLogP of -2.20, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen phosphite;oxovanadium(2+) is sourced from PubChem (CID 10888058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).