C12H18 — CID 10888240
(8S,8aS)-3,8-dimethyl-1,2,6,7,8,8a-hexahydroazulene (PubChem CID 10888240) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is (8S,8aS)-3,8-dimethyl-1,2,6,7,8,8a-hexahydroazulene.
| Compound Name | (8S,8aS)-3,8-dimethyl-1,2,6,7,8,8a-hexahydroazulene |
|---|---|
| PubChem CID | 10888240 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | (8S,8aS)-3,8-dimethyl-1,2,6,7,8,8a-hexahydroazulene |
| SMILES | CC1=C2C=CCC[C@H](C)[C@@H]2CC1 |
| InChI | InChI=1S/C12H18/c1-9-5-3-4-6-11-10(2)7-8-12(9)11/h4,6,9,12H,3,5,7-8H2,1-2H3/t9-,12-/m0/s1 |
| InChIKey | WLTLKQLUBPNLAM-CABZTGNLSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |