About 3-azido-1,5,5-trimethylcyclohexene
3-azido-1,5,5-trimethylcyclohexene (PubChem CID 10888275) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is 3-azido-1,5,5-trimethylcyclohexene.
Molecular Properties
| Compound Name | 3-azido-1,5,5-trimethylcyclohexene |
| PubChem CID | 10888275 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 3-azido-1,5,5-trimethylcyclohexene |
| SMILES | CC1=CC(N=[N+]=[N-])CC(C)(C)C1 |
| InChI | InChI=1S/C9H15N3/c1-7-4-8(11-12-10)6-9(2,3)5-7/h4,8H,5-6H2,1-3H3 |
| InChIKey | JEJFZVQTFXLFMN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-azido-1,5,5-trimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azido-1,5,5-trimethylcyclohexene?
The IUPAC name of 3-azido-1,5,5-trimethylcyclohexene (CID 10888275) is 3-azido-1,5,5-trimethylcyclohexene.
What is the SMILES notation for 3-azido-1,5,5-trimethylcyclohexene?
The canonical SMILES for 3-azido-1,5,5-trimethylcyclohexene is CC1=CC(N=[N+]=[N-])CC(C)(C)C1.
What is the InChIKey of 3-azido-1,5,5-trimethylcyclohexene?
The InChIKey is JEJFZVQTFXLFMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3/c1-7-4-8(11-12-10)6-9(2,3)5-7/h4,8H,5-6H2,1-3H3.
What are the key properties of 3-azido-1,5,5-trimethylcyclohexene?
3-azido-1,5,5-trimethylcyclohexene has a molecular weight of 165.24 g/mol, XLogP of 3.43, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azido-1,5,5-trimethylcyclohexene is sourced from PubChem (CID 10888275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).