About 3-phenyl-1,3-oxazolidine-2,4-dione
3-phenyl-1,3-oxazolidine-2,4-dione (PubChem CID 10888463) has the molecular formula C9H7NO3
and a molecular weight of 177.16 g/mol. Its IUPAC name is 3-phenyl-1,3-oxazolidine-2,4-dione.
Molecular Properties
| Compound Name | 3-phenyl-1,3-oxazolidine-2,4-dione |
| PubChem CID | 10888463 |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 3-phenyl-1,3-oxazolidine-2,4-dione |
| SMILES | O=C1COC(=O)N1c1ccccc1 |
| InChI | InChI=1S/C9H7NO3/c11-8-6-13-9(12)10(8)7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | UOAVOZAOARIKEL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-phenyl-1,3-oxazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-1,3-oxazolidine-2,4-dione?
The IUPAC name of 3-phenyl-1,3-oxazolidine-2,4-dione (CID 10888463) is 3-phenyl-1,3-oxazolidine-2,4-dione.
What is the SMILES notation for 3-phenyl-1,3-oxazolidine-2,4-dione?
The canonical SMILES for 3-phenyl-1,3-oxazolidine-2,4-dione is O=C1COC(=O)N1c1ccccc1.
What is the InChIKey of 3-phenyl-1,3-oxazolidine-2,4-dione?
The InChIKey is UOAVOZAOARIKEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO3/c11-8-6-13-9(12)10(8)7-4-2-1-3-5-7/h1-5H,6H2.
What are the key properties of 3-phenyl-1,3-oxazolidine-2,4-dione?
3-phenyl-1,3-oxazolidine-2,4-dione has a molecular weight of 177.16 g/mol, XLogP of 1.17, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-1,3-oxazolidine-2,4-dione is sourced from PubChem (CID 10888463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).