C10H12O3 — CID 10888516
1-oxaspiro[5.5]undec-3-ene-2,5-dione (PubChem CID 10888516) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 1-oxaspiro[5.5]undec-3-ene-2,5-dione.
| Compound Name | 1-oxaspiro[5.5]undec-3-ene-2,5-dione |
|---|---|
| PubChem CID | 10888516 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 1-oxaspiro[5.5]undec-3-ene-2,5-dione |
| SMILES | O=C1C=CC(=O)C2(CCCCC2)O1 |
| InChI | InChI=1S/C10H12O3/c11-8-4-5-9(12)13-10(8)6-2-1-3-7-10/h4-5H,1-3,6-7H2 |
| InChIKey | NXCYPRJURIKLQP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |