C14H13ClN2O2S — CID 108886279
1-(3-chloro-4-methoxyphenyl)-3-(2-sulfanylphenyl)urea (PubChem CID 108886279) has the molecular formula C14H13ClN2O2S and a molecular weight of 308.79 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-3-(2-sulfanylphenyl)urea.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-3-(2-sulfanylphenyl)urea |
|---|---|
| PubChem CID | 108886279 |
| Molecular Formula | C14H13ClN2O2S |
| Molecular Weight | 308.79 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-3-(2-sulfanylphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2ccccc2S)cc1Cl |
| InChI | InChI=1S/C14H13ClN2O2S/c1-19-12-7-6-9(8-10(12)15)16-14(18)17-11-4-2-3-5-13(11)20/h2-8,20H,1H3,(H2,16,17,18) |
| InChIKey | MFIIADIAURPAGK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.79 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|