About 3-tert-butyl-2,2,4-trimethylhex-5-en-3-ol
3-tert-butyl-2,2,4-trimethylhex-5-en-3-ol (PubChem CID 10888893) has the molecular formula C13H26O
and a molecular weight of 198.35 g/mol. Its IUPAC name is 3-tert-butyl-2,2,4-trimethylhex-5-en-3-ol.
Molecular Properties
| Compound Name | 3-tert-butyl-2,2,4-trimethylhex-5-en-3-ol |
| PubChem CID | 10888893 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | 3-tert-butyl-2,2,4-trimethylhex-5-en-3-ol |
| SMILES | C=CC(C)C(O)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H26O/c1-9-10(2)13(14,11(3,4)5)12(6,7)8/h9-10,14H,1H2,2-8H3 |
| InChIKey | OERARDYJBYYTKW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-2,2,4-trimethylhex-5-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-2,2,4-trimethylhex-5-en-3-ol?
The IUPAC name of 3-tert-butyl-2,2,4-trimethylhex-5-en-3-ol (CID 10888893) is 3-tert-butyl-2,2,4-trimethylhex-5-en-3-ol.
What is the SMILES notation for 3-tert-butyl-2,2,4-trimethylhex-5-en-3-ol?
The canonical SMILES for 3-tert-butyl-2,2,4-trimethylhex-5-en-3-ol is C=CC(C)C(O)(C(C)(C)C)C(C)(C)C.
What is the InChIKey of 3-tert-butyl-2,2,4-trimethylhex-5-en-3-ol?
The InChIKey is OERARDYJBYYTKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O/c1-9-10(2)13(14,11(3,4)5)12(6,7)8/h9-10,14H,1H2,2-8H3.
What are the key properties of 3-tert-butyl-2,2,4-trimethylhex-5-en-3-ol?
3-tert-butyl-2,2,4-trimethylhex-5-en-3-ol has a molecular weight of 198.35 g/mol, XLogP of 3.63, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-2,2,4-trimethylhex-5-en-3-ol is sourced from PubChem (CID 10888893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).