About 4-(4-chlorophenyl)-1,3-dioxane
4-(4-chlorophenyl)-1,3-dioxane (PubChem CID 10888898) has the molecular formula C10H11ClO2
and a molecular weight of 198.65 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1,3-dioxane.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-1,3-dioxane |
| PubChem CID | 10888898 |
| Molecular Formula | C10H11ClO2 |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 4-(4-chlorophenyl)-1,3-dioxane |
| SMILES | Clc1ccc(C2CCOCO2)cc1 |
| InChI | InChI=1S/C10H11ClO2/c11-9-3-1-8(2-4-9)10-5-6-12-7-13-10/h1-4,10H,5-7H2 |
| InChIKey | AQEBSMBBHRCHJM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-chlorophenyl)-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-1,3-dioxane?
The IUPAC name of 4-(4-chlorophenyl)-1,3-dioxane (CID 10888898) is 4-(4-chlorophenyl)-1,3-dioxane.
What is the SMILES notation for 4-(4-chlorophenyl)-1,3-dioxane?
The canonical SMILES for 4-(4-chlorophenyl)-1,3-dioxane is Clc1ccc(C2CCOCO2)cc1.
What is the InChIKey of 4-(4-chlorophenyl)-1,3-dioxane?
The InChIKey is AQEBSMBBHRCHJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO2/c11-9-3-1-8(2-4-9)10-5-6-12-7-13-10/h1-4,10H,5-7H2.
What are the key properties of 4-(4-chlorophenyl)-1,3-dioxane?
4-(4-chlorophenyl)-1,3-dioxane has a molecular weight of 198.65 g/mol, XLogP of 2.78, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-1,3-dioxane is sourced from PubChem (CID 10888898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).