About 1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-ethylurea
1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-ethylurea (PubChem CID 108890481) has the molecular formula C8H13N3O3S
and a molecular weight of 231.28 g/mol. Its IUPAC name is 1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-ethylurea.
Molecular Properties
| Compound Name | 1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-ethylurea |
| PubChem CID | 108890481 |
| Molecular Formula | C8H13N3O3S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-ethylurea |
| SMILES | CCNC(=O)NCCN1C(=O)CSC1=O |
| InChI | InChI=1S/C8H13N3O3S/c1-2-9-7(13)10-3-4-11-6(12)5-15-8(11)14/h2-5H2,1H3,(H2,9,10,13) |
| InChIKey | ZSOMUJWQEFFILI-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-ethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-ethylurea?
The IUPAC name of 1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-ethylurea (CID 108890481) is 1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-ethylurea.
What is the SMILES notation for 1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-ethylurea?
The canonical SMILES for 1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-ethylurea is CCNC(=O)NCCN1C(=O)CSC1=O.
What is the InChIKey of 1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-ethylurea?
The InChIKey is ZSOMUJWQEFFILI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O3S/c1-2-9-7(13)10-3-4-11-6(12)5-15-8(11)14/h2-5H2,1H3,(H2,9,10,13).
What are the key properties of 1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-ethylurea?
1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-ethylurea has a molecular weight of 231.28 g/mol, XLogP of 0.00, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-ethylurea is sourced from PubChem (CID 108890481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).