About 2-(2,4-dimethylphenoxy)ethyl thiocyanate
2-(2,4-dimethylphenoxy)ethyl thiocyanate (PubChem CID 10889091) has the molecular formula C11H13NOS
and a molecular weight of 207.30 g/mol. Its IUPAC name is 2-(2,4-dimethylphenoxy)ethyl thiocyanate.
Molecular Properties
| Compound Name | 2-(2,4-dimethylphenoxy)ethyl thiocyanate |
| PubChem CID | 10889091 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 2-(2,4-dimethylphenoxy)ethyl thiocyanate |
| SMILES | Cc1ccc(OCCSC#N)c(C)c1 |
| InChI | InChI=1S/C11H13NOS/c1-9-3-4-11(10(2)7-9)13-5-6-14-8-12/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | RQALBMIWHNEJLE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-dimethylphenoxy)ethyl thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dimethylphenoxy)ethyl thiocyanate?
The IUPAC name of 2-(2,4-dimethylphenoxy)ethyl thiocyanate (CID 10889091) is 2-(2,4-dimethylphenoxy)ethyl thiocyanate.
What is the SMILES notation for 2-(2,4-dimethylphenoxy)ethyl thiocyanate?
The canonical SMILES for 2-(2,4-dimethylphenoxy)ethyl thiocyanate is Cc1ccc(OCCSC#N)c(C)c1.
What is the InChIKey of 2-(2,4-dimethylphenoxy)ethyl thiocyanate?
The InChIKey is RQALBMIWHNEJLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NOS/c1-9-3-4-11(10(2)7-9)13-5-6-14-8-12/h3-4,7H,5-6H2,1-2H3.
What are the key properties of 2-(2,4-dimethylphenoxy)ethyl thiocyanate?
2-(2,4-dimethylphenoxy)ethyl thiocyanate has a molecular weight of 207.30 g/mol, XLogP of 2.90, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethylphenoxy)ethyl thiocyanate is sourced from PubChem (CID 10889091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).