About 2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine
2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine (PubChem CID 10889102) has the molecular formula C7H9N3
and a molecular weight of 135.17 g/mol. Its IUPAC name is 2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine |
| PubChem CID | 10889102 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine |
| SMILES | Cc1ncc2c(n1)CNC2 |
| InChI | InChI=1S/C7H9N3/c1-5-9-3-6-2-8-4-7(6)10-5/h3,8H,2,4H2,1H3 |
| InChIKey | RAAFDHOWTMRUEA-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine?
The IUPAC name of 2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine (CID 10889102) is 2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine.
What is the SMILES notation for 2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine?
The canonical SMILES for 2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine is Cc1ncc2c(n1)CNC2.
What is the InChIKey of 2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine?
The InChIKey is RAAFDHOWTMRUEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3/c1-5-9-3-6-2-8-4-7(6)10-5/h3,8H,2,4H2,1H3.
What are the key properties of 2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine?
2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine has a molecular weight of 135.17 g/mol, XLogP of 0.39, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine is sourced from PubChem (CID 10889102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).