C13H22O2 — CID 10889169
(3R,3aS,8S,8aS)-3-methoxy-3a,8-dimethyl-1,2,3,5,6,7,8,8a-octahydroazulen-4-one (PubChem CID 10889169) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is (3R,3aS,8S,8aS)-3-methoxy-3a,8-dimethyl-1,2,3,5,6,7,8,8a-octahydroazulen-4-one.
| Compound Name | (3R,3aS,8S,8aS)-3-methoxy-3a,8-dimethyl-1,2,3,5,6,7,8,8a-octahydroazulen-4-one |
|---|---|
| PubChem CID | 10889169 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (3R,3aS,8S,8aS)-3-methoxy-3a,8-dimethyl-1,2,3,5,6,7,8,8a-octahydroazulen-4-one |
| SMILES | CO[C@@H]1CC[C@H]2[C@@H](C)CCCC(=O)[C@]12C |
| InChI | InChI=1S/C13H22O2/c1-9-5-4-6-11(14)13(2)10(9)7-8-12(13)15-3/h9-10,12H,4-8H2,1-3H3/t9-,10-,12+,13+/m0/s1 |
| InChIKey | OOASCZWWMNXZHB-YRRQLQLVSA-N |
| XLogP | 2.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |