C8H6F5N — CID 10889182
N-ethyl-2,3,4,5,6-pentafluoroaniline (PubChem CID 10889182) has the molecular formula C8H6F5N and a molecular weight of 211.13 g/mol. Its IUPAC name is N-ethyl-2,3,4,5,6-pentafluoroaniline.
| Compound Name | N-ethyl-2,3,4,5,6-pentafluoroaniline |
|---|---|
| PubChem CID | 10889182 |
| Molecular Formula | C8H6F5N |
| Molecular Weight | 211.13 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | N-ethyl-2,3,4,5,6-pentafluoroaniline |
| SMILES | CCNc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C8H6F5N/c1-2-14-8-6(12)4(10)3(9)5(11)7(8)13/h14H,2H2,1H3 |
| InChIKey | ASLGZNSJXXGIIC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.13 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|