C16H17FN2O2 — CID 108893256
1-[(2-ethylphenoxy)methyl]-3-(4-fluorophenyl)urea (PubChem CID 108893256) has the molecular formula C16H17FN2O2 and a molecular weight of 288.32 g/mol. Its IUPAC name is 1-[(2-ethylphenoxy)methyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[(2-ethylphenoxy)methyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 108893256 |
| Molecular Formula | C16H17FN2O2 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 1-[(2-ethylphenoxy)methyl]-3-(4-fluorophenyl)urea |
| SMILES | CCc1ccccc1OCNC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C16H17FN2O2/c1-2-12-5-3-4-6-15(12)21-11-18-16(20)19-14-9-7-13(17)8-10-14/h3-10H,2,11H2,1H3,(H2,18,19,20) |
| InChIKey | QDOCEBUQWQSPDD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|