C13H14OS — CID 10889386
(1R,7aS)-1-thiophen-3-yl-1,4,5,6,7,7a-hexahydroinden-2-one (PubChem CID 10889386) has the molecular formula C13H14OS and a molecular weight of 218.32 g/mol. Its IUPAC name is (1R,7aS)-1-thiophen-3-yl-1,4,5,6,7,7a-hexahydroinden-2-one.
| Compound Name | (1R,7aS)-1-thiophen-3-yl-1,4,5,6,7,7a-hexahydroinden-2-one |
|---|---|
| PubChem CID | 10889386 |
| Molecular Formula | C13H14OS |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | (1R,7aS)-1-thiophen-3-yl-1,4,5,6,7,7a-hexahydroinden-2-one |
| SMILES | O=C1C=C2CCCC[C@H]2[C@@H]1c1ccsc1 |
| InChI | InChI=1S/C13H14OS/c14-12-7-9-3-1-2-4-11(9)13(12)10-5-6-15-8-10/h5-8,11,13H,1-4H2/t11-,13+/m1/s1 |
| InChIKey | VVYFABOPTXEYMZ-YPMHNXCESA-N |
| XLogP | 3.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |