About trimethyl-[(E)-undec-3-en-1,5-diynyl]silane
trimethyl-[(E)-undec-3-en-1,5-diynyl]silane (PubChem CID 10889394) has the molecular formula C14H22Si
and a molecular weight of 218.42 g/mol. Its IUPAC name is trimethyl-[(E)-undec-3-en-1,5-diynyl]silane.
Molecular Properties
| Compound Name | trimethyl-[(E)-undec-3-en-1,5-diynyl]silane |
| PubChem CID | 10889394 |
| Molecular Formula | C14H22Si |
| Molecular Weight | 218.42 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | trimethyl-[(E)-undec-3-en-1,5-diynyl]silane |
| SMILES | CCCCCC#C/C=C/C#C[Si](C)(C)C |
| InChI | InChI=1S/C14H22Si/c1-5-6-7-8-9-10-11-12-13-14-15(2,3)4/h11-12H,5-8H2,1-4H3/b12-11+ |
| InChIKey | VVUJAJZTONAYHB-VAWYXSNFSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(E)-undec-3-en-1,5-diynyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(E)-undec-3-en-1,5-diynyl]silane?
The IUPAC name of trimethyl-[(E)-undec-3-en-1,5-diynyl]silane (CID 10889394) is trimethyl-[(E)-undec-3-en-1,5-diynyl]silane.
What is the SMILES notation for trimethyl-[(E)-undec-3-en-1,5-diynyl]silane?
The canonical SMILES for trimethyl-[(E)-undec-3-en-1,5-diynyl]silane is CCCCCC#C/C=C/C#C[Si](C)(C)C.
What is the InChIKey of trimethyl-[(E)-undec-3-en-1,5-diynyl]silane?
The InChIKey is VVUJAJZTONAYHB-VAWYXSNFSA-N. The full InChI is InChI=1S/C14H22Si/c1-5-6-7-8-9-10-11-12-13-14-15(2,3)4/h11-12H,5-8H2,1-4H3/b12-11+.
What are the key properties of trimethyl-[(E)-undec-3-en-1,5-diynyl]silane?
trimethyl-[(E)-undec-3-en-1,5-diynyl]silane has a molecular weight of 218.42 g/mol, XLogP of 4.01, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(E)-undec-3-en-1,5-diynyl]silane is sourced from PubChem (CID 10889394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).