C8H16N2O5 — CID 108894318
2-(2-methoxyethoxymethylcarbamoylamino)propanoic acid (PubChem CID 108894318) has the molecular formula C8H16N2O5 and a molecular weight of 220.22 g/mol. Its IUPAC name is 2-(2-methoxyethoxymethylcarbamoylamino)propanoic acid.
| Compound Name | 2-(2-methoxyethoxymethylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 108894318 |
| Molecular Formula | C8H16N2O5 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 2-(2-methoxyethoxymethylcarbamoylamino)propanoic acid |
| SMILES | COCCOCNC(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C8H16N2O5/c1-6(7(11)12)10-8(13)9-5-15-4-3-14-2/h6H,3-5H2,1-2H3,(H,11,12)(H2,9,10,13) |
| InChIKey | HPNFUSHPBANVEP-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|