About 5-bromo-3,4-dihydro-2H-naphthalen-1-one
5-bromo-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 10889572) has the molecular formula C10H9BrO
and a molecular weight of 225.08 g/mol. Its IUPAC name is 5-bromo-3,4-dihydro-2H-naphthalen-1-one.
Molecular Properties
| Compound Name | 5-bromo-3,4-dihydro-2H-naphthalen-1-one |
| PubChem CID | 10889572 |
| Molecular Formula | C10H9BrO |
| Molecular Weight | 225.08 g/mol |
| Exact Mass | 223.98 |
| IUPAC Name | 5-bromo-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1CCCc2c(Br)cccc21 |
| InChI | InChI=1S/C10H9BrO/c11-9-5-1-4-8-7(9)3-2-6-10(8)12/h1,4-5H,2-3,6H2 |
| InChIKey | DMXOUYZZHVHEQR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.08 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-3,4-dihydro-2H-naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3,4-dihydro-2H-naphthalen-1-one?
The IUPAC name of 5-bromo-3,4-dihydro-2H-naphthalen-1-one (CID 10889572) is 5-bromo-3,4-dihydro-2H-naphthalen-1-one.
What is the SMILES notation for 5-bromo-3,4-dihydro-2H-naphthalen-1-one?
The canonical SMILES for 5-bromo-3,4-dihydro-2H-naphthalen-1-one is O=C1CCCc2c(Br)cccc21.
What is the InChIKey of 5-bromo-3,4-dihydro-2H-naphthalen-1-one?
The InChIKey is DMXOUYZZHVHEQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrO/c11-9-5-1-4-8-7(9)3-2-6-10(8)12/h1,4-5H,2-3,6H2.
What are the key properties of 5-bromo-3,4-dihydro-2H-naphthalen-1-one?
5-bromo-3,4-dihydro-2H-naphthalen-1-one has a molecular weight of 225.08 g/mol, XLogP of 2.97, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3,4-dihydro-2H-naphthalen-1-one is sourced from PubChem (CID 10889572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).