C12H20O4 — CID 10889659
2-[(1R,2S,3R)-2-formyl-3-hydroxy-3-methylcyclopentyl]propan-2-yl acetate (PubChem CID 10889659) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-[(1R,2S,3R)-2-formyl-3-hydroxy-3-methylcyclopentyl]propan-2-yl acetate.
| Compound Name | 2-[(1R,2S,3R)-2-formyl-3-hydroxy-3-methylcyclopentyl]propan-2-yl acetate |
|---|---|
| PubChem CID | 10889659 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 2-[(1R,2S,3R)-2-formyl-3-hydroxy-3-methylcyclopentyl]propan-2-yl acetate |
| SMILES | CC(=O)OC(C)(C)[C@@H]1CC[C@@](C)(O)[C@H]1C=O |
| InChI | InChI=1S/C12H20O4/c1-8(14)16-11(2,3)9-5-6-12(4,15)10(9)7-13/h7,9-10,15H,5-6H2,1-4H3/t9-,10+,12-/m1/s1 |
| InChIKey | WXQIBUZWCPOMQK-JFGNBEQYSA-N |
| XLogP | 1.30 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|