C14H29N3O — CID 108896891
1-tert-butyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea (PubChem CID 108896891) has the molecular formula C14H29N3O and a molecular weight of 255.41 g/mol. Its IUPAC name is 1-tert-butyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea.
| Compound Name | 1-tert-butyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 108896891 |
| Molecular Formula | C14H29N3O |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.23 |
| IUPAC Name | 1-tert-butyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea |
| SMILES | CC(C)(C)NC(=O)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C14H29N3O/c1-12(2,3)16-11(18)15-10-8-13(4,5)17-14(6,7)9-10/h10,17H,8-9H2,1-7H3,(H2,15,16,18) |
| InChIKey | VSWAGSCYAFGWBL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |