C15H16BrN3O — CID 108897082
1-(4-aminophenyl)-3-[2-(3-bromophenyl)ethyl]urea (PubChem CID 108897082) has the molecular formula C15H16BrN3O and a molecular weight of 334.22 g/mol. Its IUPAC name is 1-(4-aminophenyl)-3-[2-(3-bromophenyl)ethyl]urea.
| Compound Name | 1-(4-aminophenyl)-3-[2-(3-bromophenyl)ethyl]urea |
|---|---|
| PubChem CID | 108897082 |
| Molecular Formula | C15H16BrN3O |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 1-(4-aminophenyl)-3-[2-(3-bromophenyl)ethyl]urea |
| SMILES | Nc1ccc(NC(=O)NCCc2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C15H16BrN3O/c16-12-3-1-2-11(10-12)8-9-18-15(20)19-14-6-4-13(17)5-7-14/h1-7,10H,8-9,17H2,(H2,18,19,20) |
| InChIKey | HXZPHSRXUHZXPI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|