About [(Z)-3-chloro-2-ethoxy-3,3-difluoroprop-1-enyl]benzene
[(Z)-3-chloro-2-ethoxy-3,3-difluoroprop-1-enyl]benzene (PubChem CID 10889799) has the molecular formula C11H11ClF2O
and a molecular weight of 232.66 g/mol. Its IUPAC name is [(Z)-3-chloro-2-ethoxy-3,3-difluoroprop-1-enyl]benzene.
Molecular Properties
| Compound Name | [(Z)-3-chloro-2-ethoxy-3,3-difluoroprop-1-enyl]benzene |
| PubChem CID | 10889799 |
| Molecular Formula | C11H11ClF2O |
| Molecular Weight | 232.66 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | [(Z)-3-chloro-2-ethoxy-3,3-difluoroprop-1-enyl]benzene |
| SMILES | CCO/C(=C\c1ccccc1)C(F)(F)Cl |
| InChI | InChI=1S/C11H11ClF2O/c1-2-15-10(11(12,13)14)8-9-6-4-3-5-7-9/h3-8H,2H2,1H3/b10-8- |
| InChIKey | GSCYKXOQYKRCEZ-NTMALXAHSA-N |
| XLogP | 3.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.66 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-3-chloro-2-ethoxy-3,3-difluoroprop-1-enyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-3-chloro-2-ethoxy-3,3-difluoroprop-1-enyl]benzene?
The IUPAC name of [(Z)-3-chloro-2-ethoxy-3,3-difluoroprop-1-enyl]benzene (CID 10889799) is [(Z)-3-chloro-2-ethoxy-3,3-difluoroprop-1-enyl]benzene.
What is the SMILES notation for [(Z)-3-chloro-2-ethoxy-3,3-difluoroprop-1-enyl]benzene?
The canonical SMILES for [(Z)-3-chloro-2-ethoxy-3,3-difluoroprop-1-enyl]benzene is CCO/C(=C\c1ccccc1)C(F)(F)Cl.
What is the InChIKey of [(Z)-3-chloro-2-ethoxy-3,3-difluoroprop-1-enyl]benzene?
The InChIKey is GSCYKXOQYKRCEZ-NTMALXAHSA-N. The full InChI is InChI=1S/C11H11ClF2O/c1-2-15-10(11(12,13)14)8-9-6-4-3-5-7-9/h3-8H,2H2,1H3/b10-8-.
What are the key properties of [(Z)-3-chloro-2-ethoxy-3,3-difluoroprop-1-enyl]benzene?
[(Z)-3-chloro-2-ethoxy-3,3-difluoroprop-1-enyl]benzene has a molecular weight of 232.66 g/mol, XLogP of 3.90, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-3-chloro-2-ethoxy-3,3-difluoroprop-1-enyl]benzene is sourced from PubChem (CID 10889799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).