About 4,4-dimethyl-2-[(E)-2-phenylethenyl]-1,3-oxathiane
4,4-dimethyl-2-[(E)-2-phenylethenyl]-1,3-oxathiane (PubChem CID 10889861) has the molecular formula C14H18OS
and a molecular weight of 234.36 g/mol. Its IUPAC name is 4,4-dimethyl-2-[(E)-2-phenylethenyl]-1,3-oxathiane.
Molecular Properties
| Compound Name | 4,4-dimethyl-2-[(E)-2-phenylethenyl]-1,3-oxathiane |
| PubChem CID | 10889861 |
| Molecular Formula | C14H18OS |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 4,4-dimethyl-2-[(E)-2-phenylethenyl]-1,3-oxathiane |
| SMILES | CC1(C)CCOC(/C=C/c2ccccc2)S1 |
| InChI | InChI=1S/C14H18OS/c1-14(2)10-11-15-13(16-14)9-8-12-6-4-3-5-7-12/h3-9,13H,10-11H2,1-2H3/b9-8+ |
| InChIKey | ZBXZFUAWEWVSMI-CMDGGOBGSA-N |
| XLogP | 3.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,4-dimethyl-2-[(E)-2-phenylethenyl]-1,3-oxathiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-2-[(E)-2-phenylethenyl]-1,3-oxathiane?
The IUPAC name of 4,4-dimethyl-2-[(E)-2-phenylethenyl]-1,3-oxathiane (CID 10889861) is 4,4-dimethyl-2-[(E)-2-phenylethenyl]-1,3-oxathiane.
What is the SMILES notation for 4,4-dimethyl-2-[(E)-2-phenylethenyl]-1,3-oxathiane?
The canonical SMILES for 4,4-dimethyl-2-[(E)-2-phenylethenyl]-1,3-oxathiane is CC1(C)CCOC(/C=C/c2ccccc2)S1.
What is the InChIKey of 4,4-dimethyl-2-[(E)-2-phenylethenyl]-1,3-oxathiane?
The InChIKey is ZBXZFUAWEWVSMI-CMDGGOBGSA-N. The full InChI is InChI=1S/C14H18OS/c1-14(2)10-11-15-13(16-14)9-8-12-6-4-3-5-7-12/h3-9,13H,10-11H2,1-2H3/b9-8+.
What are the key properties of 4,4-dimethyl-2-[(E)-2-phenylethenyl]-1,3-oxathiane?
4,4-dimethyl-2-[(E)-2-phenylethenyl]-1,3-oxathiane has a molecular weight of 234.36 g/mol, XLogP of 3.96, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-2-[(E)-2-phenylethenyl]-1,3-oxathiane is sourced from PubChem (CID 10889861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).