C11H12BrN3O — CID 108899023
1-[(3-bromophenyl)methyl]-3-(2-cyanoethyl)urea (PubChem CID 108899023) has the molecular formula C11H12BrN3O and a molecular weight of 282.14 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl]-3-(2-cyanoethyl)urea.
| Compound Name | 1-[(3-bromophenyl)methyl]-3-(2-cyanoethyl)urea |
|---|---|
| PubChem CID | 108899023 |
| Molecular Formula | C11H12BrN3O |
| Molecular Weight | 282.14 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 1-[(3-bromophenyl)methyl]-3-(2-cyanoethyl)urea |
| SMILES | N#CCCNC(=O)NCc1cccc(Br)c1 |
| InChI | InChI=1S/C11H12BrN3O/c12-10-4-1-3-9(7-10)8-15-11(16)14-6-2-5-13/h1,3-4,7H,2,6,8H2,(H2,14,15,16) |
| InChIKey | ZZPVMXUYSLZCCC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.14 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|