C14H20O3 — CID 10889910
(5R,6R)-6-[(3aR,5S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-yl]-5,6-dimethylcyclohex-2-en-1-one (PubChem CID 10889910) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (5R,6R)-6-[(3aR,5S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-yl]-5,6-dimethylcyclohex-2-en-1-one.
| Compound Name | (5R,6R)-6-[(3aR,5S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-yl]-5,6-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 10889910 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (5R,6R)-6-[(3aR,5S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-yl]-5,6-dimethylcyclohex-2-en-1-one |
| SMILES | C[C@@H]1CC=CC(=O)[C@@]1(C)[C@@H]1C[C@H]2CCO[C@H]2O1 |
| InChI | InChI=1S/C14H20O3/c1-9-4-3-5-11(15)14(9,2)12-8-10-6-7-16-13(10)17-12/h3,5,9-10,12-13H,4,6-8H2,1-2H3/t9-,10-,12+,13+,14+/m1/s1 |
| InChIKey | GAHHNHKRXONFFA-JHYOHUSXSA-N |
| XLogP | 2.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |