C14H20O3 — CID 10889912
(4aS,5R,8R,8aS)-8-methoxy-5,8a-dimethyl-3-oxo-4,4a,5,6,7,8-hexahydronaphthalene-2-carbaldehyde (PubChem CID 10889912) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (4aS,5R,8R,8aS)-8-methoxy-5,8a-dimethyl-3-oxo-4,4a,5,6,7,8-hexahydronaphthalene-2-carbaldehyde.
| Compound Name | (4aS,5R,8R,8aS)-8-methoxy-5,8a-dimethyl-3-oxo-4,4a,5,6,7,8-hexahydronaphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 10889912 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (4aS,5R,8R,8aS)-8-methoxy-5,8a-dimethyl-3-oxo-4,4a,5,6,7,8-hexahydronaphthalene-2-carbaldehyde |
| SMILES | CO[C@@H]1CC[C@@H](C)[C@@H]2CC(=O)C(C=O)=C[C@@]12C |
| InChI | InChI=1S/C14H20O3/c1-9-4-5-13(17-3)14(2)7-10(8-15)12(16)6-11(9)14/h7-9,11,13H,4-6H2,1-3H3/t9-,11+,13-,14-/m1/s1 |
| InChIKey | HNODTGBTLVSRJI-QEGRKFQGSA-N |
| XLogP | 2.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|