About 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]oxane
2-[(2E)-3,7-dimethylocta-2,6-dienoxy]oxane (PubChem CID 10889987) has the molecular formula C15H26O2
and a molecular weight of 238.37 g/mol. Its IUPAC name is 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]oxane.
Molecular Properties
| Compound Name | 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]oxane |
| PubChem CID | 10889987 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]oxane |
| SMILES | CC(C)=CCC/C(C)=C/COC1CCCCO1 |
| InChI | InChI=1S/C15H26O2/c1-13(2)7-6-8-14(3)10-12-17-15-9-4-5-11-16-15/h7,10,15H,4-6,8-9,11-12H2,1-3H3/b14-10+ |
| InChIKey | JAINKEUHLGAETA-GXDHUFHOSA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]oxane?
The IUPAC name of 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]oxane (CID 10889987) is 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]oxane.
What is the SMILES notation for 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]oxane?
The canonical SMILES for 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]oxane is CC(C)=CCC/C(C)=C/COC1CCCCO1.
What is the InChIKey of 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]oxane?
The InChIKey is JAINKEUHLGAETA-GXDHUFHOSA-N. The full InChI is InChI=1S/C15H26O2/c1-13(2)7-6-8-14(3)10-12-17-15-9-4-5-11-16-15/h7,10,15H,4-6,8-9,11-12H2,1-3H3/b14-10+.
What are the key properties of 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]oxane?
2-[(2E)-3,7-dimethylocta-2,6-dienoxy]oxane has a molecular weight of 238.37 g/mol, XLogP of 4.22, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]oxane is sourced from PubChem (CID 10889987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).