C20H17N5O2 — CID 1089007
4-phenyl-1,2-bis(pyridin-2-ylmethyl)-1,2,4-triazolidine-3,5-dione (PubChem CID 1089007) has the molecular formula C20H17N5O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is 4-phenyl-1,2-bis(pyridin-2-ylmethyl)-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-phenyl-1,2-bis(pyridin-2-ylmethyl)-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 1089007 |
| Molecular Formula | C20H17N5O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 4-phenyl-1,2-bis(pyridin-2-ylmethyl)-1,2,4-triazolidine-3,5-dione |
| SMILES | O=c1n(-c2ccccc2)c(=O)n(Cc2ccccn2)n1Cc1ccccn1 |
| InChI | InChI=1S/C20H17N5O2/c26-19-23(14-16-8-4-6-12-21-16)24(15-17-9-5-7-13-22-17)20(27)25(19)18-10-2-1-3-11-18/h1-13H,14-15H2 |
| InChIKey | YOKBMPZHWXLMDP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 74.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |