C14H26O3 — CID 10890082
[(1S,2R)-2-[5-(oxan-2-yloxy)pentyl]cyclopropyl]methanol (PubChem CID 10890082) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is [(1S,2R)-2-[5-(oxan-2-yloxy)pentyl]cyclopropyl]methanol.
| Compound Name | [(1S,2R)-2-[5-(oxan-2-yloxy)pentyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 10890082 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | [(1S,2R)-2-[5-(oxan-2-yloxy)pentyl]cyclopropyl]methanol |
| SMILES | OC[C@H]1C[C@H]1CCCCCOC1CCCCO1 |
| InChI | InChI=1S/C14H26O3/c15-11-13-10-12(13)6-2-1-4-8-16-14-7-3-5-9-17-14/h12-15H,1-11H2/t12-,13-,14?/m1/s1 |
| InChIKey | INTCKPZURIDDKH-ZFXTZCCVSA-N |
| XLogP | 2.72 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|