About (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethylpent-4-enal
(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethylpent-4-enal (PubChem CID 10890088) has the molecular formula C13H26O2Si
and a molecular weight of 242.43 g/mol. Its IUPAC name is (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethylpent-4-enal.
Molecular Properties
| Compound Name | (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethylpent-4-enal |
| PubChem CID | 10890088 |
| Molecular Formula | C13H26O2Si |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethylpent-4-enal |
| SMILES | C=C(C)[C@@H](C)[C@H](C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H26O2Si/c1-10(2)11(3)12(9-14)15-16(7,8)13(4,5)6/h9,11-12H,1H2,2-8H3/t11-,12+/m1/s1 |
| InChIKey | CAUKIXZJAIIPMX-NEPJUHHUSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethylpent-4-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethylpent-4-enal?
The IUPAC name of (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethylpent-4-enal (CID 10890088) is (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethylpent-4-enal.
What is the SMILES notation for (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethylpent-4-enal?
The canonical SMILES for (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethylpent-4-enal is C=C(C)[C@@H](C)[C@H](C=O)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethylpent-4-enal?
The InChIKey is CAUKIXZJAIIPMX-NEPJUHHUSA-N. The full InChI is InChI=1S/C13H26O2Si/c1-10(2)11(3)12(9-14)15-16(7,8)13(4,5)6/h9,11-12H,1H2,2-8H3/t11-,12+/m1/s1.
What are the key properties of (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethylpent-4-enal?
(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethylpent-4-enal has a molecular weight of 242.43 g/mol, XLogP of 3.79, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethylpent-4-enal is sourced from PubChem (CID 10890088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).