C15H20N2O — CID 10890155
[(1R,2R,4aS,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-imidazol-1-ylmethanone (PubChem CID 10890155) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is [(1R,2R,4aS,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-imidazol-1-ylmethanone.
| Compound Name | [(1R,2R,4aS,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-imidazol-1-ylmethanone |
|---|---|
| PubChem CID | 10890155 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | [(1R,2R,4aS,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-imidazol-1-ylmethanone |
| SMILES | C[C@@H]1C=C[C@@H]2CCCC[C@H]2[C@@H]1C(=O)n1ccnc1 |
| InChI | InChI=1S/C15H20N2O/c1-11-6-7-12-4-2-3-5-13(12)14(11)15(18)17-9-8-16-10-17/h6-14H,2-5H2,1H3/t11-,12+,13-,14-/m1/s1 |
| InChIKey | PNOJIWGZBXMRLF-XJFOESAGSA-N |
| XLogP | 3.15 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|