About 1-tert-butyl-5-methyl-3,5-dinitro-1,3-diazinane
1-tert-butyl-5-methyl-3,5-dinitro-1,3-diazinane (PubChem CID 10890196) has the molecular formula C9H18N4O4
and a molecular weight of 246.27 g/mol. Its IUPAC name is 1-tert-butyl-5-methyl-3,5-dinitro-1,3-diazinane.
Molecular Properties
| Compound Name | 1-tert-butyl-5-methyl-3,5-dinitro-1,3-diazinane |
| PubChem CID | 10890196 |
| Molecular Formula | C9H18N4O4 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 1-tert-butyl-5-methyl-3,5-dinitro-1,3-diazinane |
| SMILES | CC(C)(C)N1CN([N+](=O)[O-])CC(C)([N+](=O)[O-])C1 |
| InChI | InChI=1S/C9H18N4O4/c1-8(2,3)10-5-9(4,12(14)15)6-11(7-10)13(16)17/h5-7H2,1-4H3 |
| InChIKey | QDAAIAPGJRGIRM-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-5-methyl-3,5-dinitro-1,3-diazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-5-methyl-3,5-dinitro-1,3-diazinane?
The IUPAC name of 1-tert-butyl-5-methyl-3,5-dinitro-1,3-diazinane (CID 10890196) is 1-tert-butyl-5-methyl-3,5-dinitro-1,3-diazinane.
What is the SMILES notation for 1-tert-butyl-5-methyl-3,5-dinitro-1,3-diazinane?
The canonical SMILES for 1-tert-butyl-5-methyl-3,5-dinitro-1,3-diazinane is CC(C)(C)N1CN([N+](=O)[O-])CC(C)([N+](=O)[O-])C1.
What is the InChIKey of 1-tert-butyl-5-methyl-3,5-dinitro-1,3-diazinane?
The InChIKey is QDAAIAPGJRGIRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4O4/c1-8(2,3)10-5-9(4,12(14)15)6-11(7-10)13(16)17/h5-7H2,1-4H3.
What are the key properties of 1-tert-butyl-5-methyl-3,5-dinitro-1,3-diazinane?
1-tert-butyl-5-methyl-3,5-dinitro-1,3-diazinane has a molecular weight of 246.27 g/mol, XLogP of 0.59, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-5-methyl-3,5-dinitro-1,3-diazinane is sourced from PubChem (CID 10890196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).