About 3-methyl-4-methylidenespiro[cyclopentane-1,9'-fluorene]
3-methyl-4-methylidenespiro[cyclopentane-1,9'-fluorene] (PubChem CID 10890210) has the molecular formula C19H18
and a molecular weight of 246.35 g/mol. Its IUPAC name is 3-methyl-4-methylidenespiro[cyclopentane-1,9'-fluorene].
Molecular Properties
| Compound Name | 3-methyl-4-methylidenespiro[cyclopentane-1,9'-fluorene] |
| PubChem CID | 10890210 |
| Molecular Formula | C19H18 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 3-methyl-4-methylidenespiro[cyclopentane-1,9'-fluorene] |
| SMILES | C=C1CC2(CC1C)c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C19H18/c1-13-11-19(12-14(13)2)17-9-5-3-7-15(17)16-8-4-6-10-18(16)19/h3-10,14H,1,11-12H2,2H3 |
| InChIKey | DSUFIANBXQMFOZ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-4-methylidenespiro[cyclopentane-1,9'-fluorene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-methylidenespiro[cyclopentane-1,9'-fluorene]?
The IUPAC name of 3-methyl-4-methylidenespiro[cyclopentane-1,9'-fluorene] (CID 10890210) is 3-methyl-4-methylidenespiro[cyclopentane-1,9'-fluorene].
What is the SMILES notation for 3-methyl-4-methylidenespiro[cyclopentane-1,9'-fluorene]?
The canonical SMILES for 3-methyl-4-methylidenespiro[cyclopentane-1,9'-fluorene] is C=C1CC2(CC1C)c1ccccc1-c1ccccc12.
What is the InChIKey of 3-methyl-4-methylidenespiro[cyclopentane-1,9'-fluorene]?
The InChIKey is DSUFIANBXQMFOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18/c1-13-11-19(12-14(13)2)17-9-5-3-7-15(17)16-8-4-6-10-18(16)19/h3-10,14H,1,11-12H2,2H3.
What are the key properties of 3-methyl-4-methylidenespiro[cyclopentane-1,9'-fluorene]?
3-methyl-4-methylidenespiro[cyclopentane-1,9'-fluorene] has a molecular weight of 246.35 g/mol, XLogP of 4.94, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-methylidenespiro[cyclopentane-1,9'-fluorene] is sourced from PubChem (CID 10890210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).