C3H8O9P2 — CID 10890310
(2-oxo-3-phosphonooxypropyl) dihydrogen phosphate (PubChem CID 10890310) has the molecular formula C3H8O9P2 and a molecular weight of 250.04 g/mol. Its IUPAC name is (2-oxo-3-phosphonooxypropyl) dihydrogen phosphate.
| Compound Name | (2-oxo-3-phosphonooxypropyl) dihydrogen phosphate |
|---|---|
| PubChem CID | 10890310 |
| Molecular Formula | C3H8O9P2 |
| Molecular Weight | 250.04 g/mol |
| Exact Mass | 249.96 |
| IUPAC Name | (2-oxo-3-phosphonooxypropyl) dihydrogen phosphate |
| SMILES | O=C(COP(=O)(O)O)COP(=O)(O)O |
| InChI | InChI=1S/C3H8O9P2/c4-3(1-11-13(5,6)7)2-12-14(8,9)10/h1-2H2,(H2,5,6,7)(H2,8,9,10) |
| InChIKey | WWZHNXWNOWOTFS-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.04 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|