C15H22O3 — CID 10890333
(3R,4R,4aR,9R)-3,9-dihydroxy-1,4,4a,7-tetramethyl-4,5,8,9-tetrahydro-3H-benzo[7]annulen-2-one (PubChem CID 10890333) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (3R,4R,4aR,9R)-3,9-dihydroxy-1,4,4a,7-tetramethyl-4,5,8,9-tetrahydro-3H-benzo[7]annulen-2-one.
| Compound Name | (3R,4R,4aR,9R)-3,9-dihydroxy-1,4,4a,7-tetramethyl-4,5,8,9-tetrahydro-3H-benzo[7]annulen-2-one |
|---|---|
| PubChem CID | 10890333 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (3R,4R,4aR,9R)-3,9-dihydroxy-1,4,4a,7-tetramethyl-4,5,8,9-tetrahydro-3H-benzo[7]annulen-2-one |
| SMILES | CC1=CC[C@@]2(C)C(=C(C)C(=O)[C@H](O)[C@@H]2C)[C@H](O)C1 |
| InChI | InChI=1S/C15H22O3/c1-8-5-6-15(4)10(3)14(18)13(17)9(2)12(15)11(16)7-8/h5,10-11,14,16,18H,6-7H2,1-4H3/t10-,11+,14+,15+/m0/s1 |
| InChIKey | STLDUPLKJSWMBL-RBDSIQFVSA-N |
| XLogP | 1.99 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|