About 2-[[(2S,3R)-3-(carboxymethylamino)-2-bicyclo[2.2.2]octanyl]amino]acetic acid
2-[[(2S,3R)-3-(carboxymethylamino)-2-bicyclo[2.2.2]octanyl]amino]acetic acid (PubChem CID 10890515) has the molecular formula C12H20N2O4
and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-[[(2S,3R)-3-(carboxymethylamino)-2-bicyclo[2.2.2]octanyl]amino]acetic acid.
Molecular Properties
| Compound Name | 2-[[(2S,3R)-3-(carboxymethylamino)-2-bicyclo[2.2.2]octanyl]amino]acetic acid |
| PubChem CID | 10890515 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 2-[[(2S,3R)-3-(carboxymethylamino)-2-bicyclo[2.2.2]octanyl]amino]acetic acid |
| SMILES | O=C(O)CN[C@@H]1C2CCC(CC2)[C@@H]1NCC(=O)O |
| InChI | InChI=1S/C12H20N2O4/c15-9(16)5-13-11-7-1-2-8(4-3-7)12(11)14-6-10(17)18/h7-8,11-14H,1-6H2,(H,15,16)(H,17,18)/t7?,8?,11-,12+ |
| InChIKey | ZIYCNHNFEGEVEP-MRUWNMPWSA-N |
| XLogP | -0.11 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[(2S,3R)-3-(carboxymethylamino)-2-bicyclo[2.2.2]octanyl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2S,3R)-3-(carboxymethylamino)-2-bicyclo[2.2.2]octanyl]amino]acetic acid?
The IUPAC name of 2-[[(2S,3R)-3-(carboxymethylamino)-2-bicyclo[2.2.2]octanyl]amino]acetic acid (CID 10890515) is 2-[[(2S,3R)-3-(carboxymethylamino)-2-bicyclo[2.2.2]octanyl]amino]acetic acid.
What is the SMILES notation for 2-[[(2S,3R)-3-(carboxymethylamino)-2-bicyclo[2.2.2]octanyl]amino]acetic acid?
The canonical SMILES for 2-[[(2S,3R)-3-(carboxymethylamino)-2-bicyclo[2.2.2]octanyl]amino]acetic acid is O=C(O)CN[C@@H]1C2CCC(CC2)[C@@H]1NCC(=O)O.
What is the InChIKey of 2-[[(2S,3R)-3-(carboxymethylamino)-2-bicyclo[2.2.2]octanyl]amino]acetic acid?
The InChIKey is ZIYCNHNFEGEVEP-MRUWNMPWSA-N. The full InChI is InChI=1S/C12H20N2O4/c15-9(16)5-13-11-7-1-2-8(4-3-7)12(11)14-6-10(17)18/h7-8,11-14H,1-6H2,(H,15,16)(H,17,18)/t7?,8?,11-,12+.
What are the key properties of 2-[[(2S,3R)-3-(carboxymethylamino)-2-bicyclo[2.2.2]octanyl]amino]acetic acid?
2-[[(2S,3R)-3-(carboxymethylamino)-2-bicyclo[2.2.2]octanyl]amino]acetic acid has a molecular weight of 256.30 g/mol, XLogP of -0.11, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2S,3R)-3-(carboxymethylamino)-2-bicyclo[2.2.2]octanyl]amino]acetic acid is sourced from PubChem (CID 10890515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).