About 7-nitro-5-phenyl-[1,2,4]triazolo[4,3-a]quinazoline
7-nitro-5-phenyl-[1,2,4]triazolo[4,3-a]quinazoline (PubChem CID 1089057) has the molecular formula C15H9N5O2
and a molecular weight of 291.27 g/mol. Its IUPAC name is 7-nitro-5-phenyl-[1,2,4]triazolo[4,3-a]quinazoline.
Molecular Properties
| Compound Name | 7-nitro-5-phenyl-[1,2,4]triazolo[4,3-a]quinazoline |
| PubChem CID | 1089057 |
| Molecular Formula | C15H9N5O2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 7-nitro-5-phenyl-[1,2,4]triazolo[4,3-a]quinazoline |
| SMILES | O=[N+]([O-])c1ccc2c(c1)c(-c1ccccc1)nc1nncn12 |
| InChI | InChI=1S/C15H9N5O2/c21-20(22)11-6-7-13-12(8-11)14(10-4-2-1-3-5-10)17-15-18-16-9-19(13)15/h1-9H |
| InChIKey | IRDCSFVFDZHPOZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 86.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-nitro-5-phenyl-[1,2,4]triazolo[4,3-a]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-nitro-5-phenyl-[1,2,4]triazolo[4,3-a]quinazoline?
The IUPAC name of 7-nitro-5-phenyl-[1,2,4]triazolo[4,3-a]quinazoline (CID 1089057) is 7-nitro-5-phenyl-[1,2,4]triazolo[4,3-a]quinazoline.
What is the SMILES notation for 7-nitro-5-phenyl-[1,2,4]triazolo[4,3-a]quinazoline?
The canonical SMILES for 7-nitro-5-phenyl-[1,2,4]triazolo[4,3-a]quinazoline is O=[N+]([O-])c1ccc2c(c1)c(-c1ccccc1)nc1nncn12.
What is the InChIKey of 7-nitro-5-phenyl-[1,2,4]triazolo[4,3-a]quinazoline?
The InChIKey is IRDCSFVFDZHPOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9N5O2/c21-20(22)11-6-7-13-12(8-11)14(10-4-2-1-3-5-10)17-15-18-16-9-19(13)15/h1-9H.
What are the key properties of 7-nitro-5-phenyl-[1,2,4]triazolo[4,3-a]quinazoline?
7-nitro-5-phenyl-[1,2,4]triazolo[4,3-a]quinazoline has a molecular weight of 291.27 g/mol, XLogP of 2.85, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-nitro-5-phenyl-[1,2,4]triazolo[4,3-a]quinazoline is sourced from PubChem (CID 1089057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).