C13H26O3Si — CID 10890590
(3S,4S,5E)-3-(2-trimethylsilylethoxymethoxy)hepta-1,5-dien-4-ol (PubChem CID 10890590) has the molecular formula C13H26O3Si and a molecular weight of 258.43 g/mol. Its IUPAC name is (3S,4S,5E)-3-(2-trimethylsilylethoxymethoxy)hepta-1,5-dien-4-ol.
| Compound Name | (3S,4S,5E)-3-(2-trimethylsilylethoxymethoxy)hepta-1,5-dien-4-ol |
|---|---|
| PubChem CID | 10890590 |
| Molecular Formula | C13H26O3Si |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (3S,4S,5E)-3-(2-trimethylsilylethoxymethoxy)hepta-1,5-dien-4-ol |
| SMILES | C=C[C@H](OCOCC[Si](C)(C)C)[C@@H](O)/C=C/C |
| InChI | InChI=1S/C13H26O3Si/c1-6-8-12(14)13(7-2)16-11-15-9-10-17(3,4)5/h6-8,12-14H,2,9-11H2,1,3-5H3/b8-6+/t12-,13-/m0/s1 |
| InChIKey | CHCULNIHHJAGLK-KELULYIISA-N |
| XLogP | 2.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|