C7H4Cl4O2 — CID 10890662
(1S,5R)-2,2,4,4-tetrachloro-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 10890662) has the molecular formula C7H4Cl4O2 and a molecular weight of 261.92 g/mol. Its IUPAC name is (1S,5R)-2,2,4,4-tetrachloro-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1S,5R)-2,2,4,4-tetrachloro-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 10890662 |
| Molecular Formula | C7H4Cl4O2 |
| Molecular Weight | 261.92 g/mol |
| Exact Mass | 259.90 |
| IUPAC Name | (1S,5R)-2,2,4,4-tetrachloro-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | O=C1C(Cl)(Cl)[C@@H]2C=C[C@@H](O2)C1(Cl)Cl |
| InChI | InChI=1S/C7H4Cl4O2/c8-6(9)3-1-2-4(13-3)7(10,11)5(6)12/h1-4H/t3-,4+ |
| InChIKey | IULGTBBRTYBGNC-ZXZARUISSA-N |
| XLogP | 2.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.92 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|